C22H43NO5 — CID 156538832
[bis(2-hydroxyethyl)amino] (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 156538832) has the molecular formula C22H43NO5 and a molecular weight of 401.59 g/mol. Its IUPAC name is [bis(2-hydroxyethyl)amino] (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [bis(2-hydroxyethyl)amino] (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 156538832 |
| Molecular Formula | C22H43NO5 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | [bis(2-hydroxyethyl)amino] (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)ON(CCO)CCO |
| InChI | InChI=1S/C22H43NO5/c1-2-3-4-11-14-21(26)15-12-9-7-5-6-8-10-13-16-22(27)28-23(17-19-24)18-20-25/h9,12,21,24-26H,2-8,10-11,13-20H2,1H3/b12-9-/t21-/m1/s1 |
| InChIKey | YCZNWVBDCKHZIE-ZDKIGPTLSA-N |
| XLogP | 3.74 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|