C15H30N2O6 — CID 146434374
5-[[bis(2-hydroxyethyl)amino]methyl]-N,N-bis(2-hydroxyethyl)-6-oxohexanamide (PubChem CID 146434374) has the molecular formula C15H30N2O6 and a molecular weight of 334.41 g/mol. Its IUPAC name is 5-[[bis(2-hydroxyethyl)amino]methyl]-N,N-bis(2-hydroxyethyl)-6-oxohexanamide.
| Compound Name | 5-[[bis(2-hydroxyethyl)amino]methyl]-N,N-bis(2-hydroxyethyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 146434374 |
| Molecular Formula | C15H30N2O6 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 5-[[bis(2-hydroxyethyl)amino]methyl]-N,N-bis(2-hydroxyethyl)-6-oxohexanamide |
| SMILES | O=CC(CCCC(=O)N(CCO)CCO)CN(CCO)CCO |
| InChI | InChI=1S/C15H30N2O6/c18-8-4-16(5-9-19)12-14(13-22)2-1-3-15(23)17(6-10-20)7-11-21/h13-14,18-21H,1-12H2 |
| InChIKey | OVVNYUBOFUPDIC-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|