About [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate
[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate (PubChem CID 131718524) has the molecular formula C8H16N2O5
and a molecular weight of 220.22 g/mol. Its IUPAC name is [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate.
Molecular Properties
| Compound Name | [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate |
| PubChem CID | 131718524 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate |
| SMILES | NCC(=O)OCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C8H16N2O5/c9-5-8(14)15-6-7(13)10(1-3-11)2-4-12/h11-12H,1-6,9H2 |
| InChIKey | MYXRLSIBACNQMP-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate?
The IUPAC name of [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate (CID 131718524) is [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate.
What is the SMILES notation for [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate?
The canonical SMILES for [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate is NCC(=O)OCC(=O)N(CCO)CCO.
What is the InChIKey of [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate?
The InChIKey is MYXRLSIBACNQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O5/c9-5-8(14)15-6-7(13)10(1-3-11)2-4-12/h11-12H,1-6,9H2.
What are the key properties of [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate?
[2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate has a molecular weight of 220.22 g/mol, XLogP of -2.70, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[bis(2-hydroxyethyl)amino]-2-oxoethyl] 2-aminoacetate is sourced from PubChem (CID 131718524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).