C59H117N3O6 — CID 174303360
2-[3-[2-(dioctylamino)-2-oxoethoxy]-2-[[2-(dioctylamino)-2-oxoethoxy]methyl]-2-methylpropoxy]-N,N-dioctylacetamide (PubChem CID 174303360) has the molecular formula C59H117N3O6 and a molecular weight of 964.60 g/mol. Its IUPAC name is 2-[3-[2-(dioctylamino)-2-oxoethoxy]-2-[[2-(dioctylamino)-2-oxoethoxy]methyl]-2-methylpropoxy]-N,N-dioctylacetamide.
| Compound Name | 2-[3-[2-(dioctylamino)-2-oxoethoxy]-2-[[2-(dioctylamino)-2-oxoethoxy]methyl]-2-methylpropoxy]-N,N-dioctylacetamide |
|---|---|
| PubChem CID | 174303360 |
| Molecular Formula | C59H117N3O6 |
| Molecular Weight | 964.60 g/mol |
| Exact Mass | 963.89 |
| IUPAC Name | 2-[3-[2-(dioctylamino)-2-oxoethoxy]-2-[[2-(dioctylamino)-2-oxoethoxy]methyl]-2-methylpropoxy]-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)COCC(C)(COCC(=O)N(CCCCCCCC)CCCCCCCC)COCC(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C59H117N3O6/c1-8-14-20-26-32-38-44-60(45-39-33-27-21-15-9-2)56(63)50-66-53-59(7,54-67-51-57(64)61(46-40-34-28-22-16-10-3)47-41-35-29-23-17-11-4)55-68-52-58(65)62(48-42-36-30-24-18-12-5)49-43-37-31-25-19-13-6/h8-55H2,1-7H3 |
| InChIKey | CULVSHARVVCPLV-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.60 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|