C27H56NO3P — CID 102344381
2-(dibutylphosphorylmethoxy)-N,N-dioctylacetamide (PubChem CID 102344381) has the molecular formula C27H56NO3P and a molecular weight of 473.72 g/mol. Its IUPAC name is 2-(dibutylphosphorylmethoxy)-N,N-dioctylacetamide.
| Compound Name | 2-(dibutylphosphorylmethoxy)-N,N-dioctylacetamide |
|---|---|
| PubChem CID | 102344381 |
| Molecular Formula | C27H56NO3P |
| Molecular Weight | 473.72 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | 2-(dibutylphosphorylmethoxy)-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)COCP(=O)(CCCC)CCCC |
| InChI | InChI=1S/C27H56NO3P/c1-5-9-13-15-17-19-21-28(22-20-18-16-14-10-6-2)27(29)25-31-26-32(30,23-11-7-3)24-12-8-4/h5-26H2,1-4H3 |
| InChIKey | YZEJSNGDFJZTDP-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|