C19H40N2O2 — CID 175987181
2-[2-[ethyl(methyl)amino]ethoxy]-N,N-dihexylacetamide (PubChem CID 175987181) has the molecular formula C19H40N2O2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 2-[2-[ethyl(methyl)amino]ethoxy]-N,N-dihexylacetamide.
| Compound Name | 2-[2-[ethyl(methyl)amino]ethoxy]-N,N-dihexylacetamide |
|---|---|
| PubChem CID | 175987181 |
| Molecular Formula | C19H40N2O2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | 2-[2-[ethyl(methyl)amino]ethoxy]-N,N-dihexylacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)COCCN(C)CC |
| InChI | InChI=1S/C19H40N2O2/c1-5-8-10-12-14-21(15-13-11-9-6-2)19(22)18-23-17-16-20(4)7-3/h5-18H2,1-4H3 |
| InChIKey | UZXQXOSIKPJFPU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|