C7H18AlNO2 — CID 156656248
2-(3-alumanyloxypropoxy)-N,N-dimethylethanamine (PubChem CID 156656248) has the molecular formula C7H18AlNO2 and a molecular weight of 175.21 g/mol. Its IUPAC name is 2-(3-alumanyloxypropoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(3-alumanyloxypropoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 156656248 |
| Molecular Formula | C7H18AlNO2 |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2-(3-alumanyloxypropoxy)-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCCCO[AlH2] |
| InChI | InChI=1S/C7H16NO2.Al.2H/c1-8(2)4-7-10-6-3-5-9;;;/h3-7H2,1-2H3;;;/q-1;+1;; |
| InChIKey | SNORBTRXFWAXMN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|