C10H22N4O3 — CID 150469867
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N,N-dimethylethanamine (PubChem CID 150469867) has the molecular formula C10H22N4O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 150469867 |
| Molecular Formula | C10H22N4O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C10H22N4O3/c1-14(2)4-6-16-8-10-17-9-7-15-5-3-12-13-11/h3-10H2,1-2H3 |
| InChIKey | HROPUYBDUIHROX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|