C10H16O6 — CID 88588608
3-[(Z)-4-(2-carboxyethoxy)but-2-enoxy]propanoic acid (PubChem CID 88588608) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-[(Z)-4-(2-carboxyethoxy)but-2-enoxy]propanoic acid.
| Compound Name | 3-[(Z)-4-(2-carboxyethoxy)but-2-enoxy]propanoic acid |
|---|---|
| PubChem CID | 88588608 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-[(Z)-4-(2-carboxyethoxy)but-2-enoxy]propanoic acid |
| SMILES | O=C(O)CCOC/C=C\COCCC(=O)O |
| InChI | InChI=1S/C10H16O6/c11-9(12)3-7-15-5-1-2-6-16-8-4-10(13)14/h1-2H,3-8H2,(H,11,12)(H,13,14)/b2-1- |
| InChIKey | YMQYVJKEPGHLLD-UPHRSURJSA-N |
| XLogP | 0.53 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|