About 2-ethoxyethyl(triethyl)azanium;ethyl carbonate
2-ethoxyethyl(triethyl)azanium;ethyl carbonate (PubChem CID 167445600) has the molecular formula C13H29NO4
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-ethoxyethyl(triethyl)azanium;ethyl carbonate.
Molecular Properties
| Compound Name | 2-ethoxyethyl(triethyl)azanium;ethyl carbonate |
| PubChem CID | 167445600 |
| Molecular Formula | C13H29NO4 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 2-ethoxyethyl(triethyl)azanium;ethyl carbonate |
| SMILES | CCOC(=O)[O-].CCOCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C10H24NO.C3H6O3/c1-5-11(6-2,7-3)9-10-12-8-4;1-2-6-3(4)5/h5-10H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | MRGLVSPGPABCDY-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl(triethyl)azanium;ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl(triethyl)azanium;ethyl carbonate?
The IUPAC name of 2-ethoxyethyl(triethyl)azanium;ethyl carbonate (CID 167445600) is 2-ethoxyethyl(triethyl)azanium;ethyl carbonate.
What is the SMILES notation for 2-ethoxyethyl(triethyl)azanium;ethyl carbonate?
The canonical SMILES for 2-ethoxyethyl(triethyl)azanium;ethyl carbonate is CCOC(=O)[O-].CCOCC[N+](CC)(CC)CC.
What is the InChIKey of 2-ethoxyethyl(triethyl)azanium;ethyl carbonate?
The InChIKey is MRGLVSPGPABCDY-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H24NO.C3H6O3/c1-5-11(6-2,7-3)9-10-12-8-4;1-2-6-3(4)5/h5-10H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of 2-ethoxyethyl(triethyl)azanium;ethyl carbonate?
2-ethoxyethyl(triethyl)azanium;ethyl carbonate has a molecular weight of 263.38 g/mol, XLogP of 1.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl(triethyl)azanium;ethyl carbonate is sourced from PubChem (CID 167445600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).