C32H68N2O7 — CID 142691420
2-hydroxybutanedioate;bis(tributyl(2-hydroxyethyl)azanium) (PubChem CID 142691420) has the molecular formula C32H68N2O7 and a molecular weight of 592.90 g/mol. Its IUPAC name is 2-hydroxybutanedioate;bis(tributyl(2-hydroxyethyl)azanium).
| Compound Name | 2-hydroxybutanedioate;bis(tributyl(2-hydroxyethyl)azanium) |
|---|---|
| PubChem CID | 142691420 |
| Molecular Formula | C32H68N2O7 |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.50 |
| IUPAC Name | 2-hydroxybutanedioate;bis(tributyl(2-hydroxyethyl)azanium) |
| SMILES | CCCC[N+](CCO)(CCCC)CCCC.CCCC[N+](CCO)(CCCC)CCCC.O=C([O-])CC(O)C(=O)[O-] |
| InChI | InChI=1S/2C14H32NO.C4H6O5/c2*1-4-7-10-15(13-14-16,11-8-5-2)12-9-6-3;5-2(4(8)9)1-3(6)7/h2*16H,4-14H2,1-3H3;2,5H,1H2,(H,6,7)(H,8,9)/q2*+1;/p-2 |
| InChIKey | YNMQYKWLRMQIKZ-UHFFFAOYSA-L |
| XLogP | 2.63 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|