About 6-hydroxyhexanoate;tetrabutylazanium
6-hydroxyhexanoate;tetrabutylazanium (PubChem CID 156828244) has the molecular formula C22H47NO3
and a molecular weight of 373.62 g/mol. Its IUPAC name is 6-hydroxyhexanoate;tetrabutylazanium.
Molecular Properties
| Compound Name | 6-hydroxyhexanoate;tetrabutylazanium |
| PubChem CID | 156828244 |
| Molecular Formula | C22H47NO3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 373.36 |
| IUPAC Name | 6-hydroxyhexanoate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])CCCCCO |
| InChI | InChI=1S/C16H36N.C6H12O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-5-3-1-2-4-6(8)9/h5-16H2,1-4H3;7H,1-5H2,(H,8,9)/q+1;/p-1 |
| InChIKey | GWABLWXJWLLASH-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexanoate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexanoate;tetrabutylazanium?
The IUPAC name of 6-hydroxyhexanoate;tetrabutylazanium (CID 156828244) is 6-hydroxyhexanoate;tetrabutylazanium.
What is the SMILES notation for 6-hydroxyhexanoate;tetrabutylazanium?
The canonical SMILES for 6-hydroxyhexanoate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])CCCCCO.
What is the InChIKey of 6-hydroxyhexanoate;tetrabutylazanium?
The InChIKey is GWABLWXJWLLASH-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C6H12O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-5-3-1-2-4-6(8)9/h5-16H2,1-4H3;7H,1-5H2,(H,8,9)/q+1;/p-1.
What are the key properties of 6-hydroxyhexanoate;tetrabutylazanium?
6-hydroxyhexanoate;tetrabutylazanium has a molecular weight of 373.62 g/mol, XLogP of 4.29, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexanoate;tetrabutylazanium is sourced from PubChem (CID 156828244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).