C21H47NO2PS+ — CID 87299364
2-amino-4-methylsulfanylbutanoic acid;tetrabutylphosphanium (PubChem CID 87299364) has the molecular formula C21H47NO2PS+ and a molecular weight of 408.65 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;tetrabutylphosphanium.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;tetrabutylphosphanium |
|---|---|
| PubChem CID | 87299364 |
| Molecular Formula | C21H47NO2PS+ |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.CSCCC(N)C(=O)O |
| InChI | InChI=1S/C16H36P.C5H11NO2S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-9-3-2-4(6)5(7)8/h5-16H2,1-4H3;4H,2-3,6H2,1H3,(H,7,8)/q+1; |
| InChIKey | RVSJTJOBOWNACP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|