C9H20N2O2S — CID 104908350
(2R)-2-amino-N-(2-hydroxypropyl)-N-methyl-4-methylsulfanylbutanamide (PubChem CID 104908350) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-hydroxypropyl)-N-methyl-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-hydroxypropyl)-N-methyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104908350 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2R)-2-amino-N-(2-hydroxypropyl)-N-methyl-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)N(C)CC(C)O |
| InChI | InChI=1S/C9H20N2O2S/c1-7(12)6-11(2)9(13)8(10)4-5-14-3/h7-8,12H,4-6,10H2,1-3H3/t7?,8-/m1/s1 |
| InChIKey | FGNSLBVRNZUFOA-BRFYHDHCSA-N |
| XLogP | -0.09 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |