C11H24N2OS — CID 61165499
(2S)-2-amino-N-methyl-N-(3-methylbutyl)-4-methylsulfanylbutanamide (PubChem CID 61165499) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is (2S)-2-amino-N-methyl-N-(3-methylbutyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-methyl-N-(3-methylbutyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61165499 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (2S)-2-amino-N-methyl-N-(3-methylbutyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)N(C)CCC(C)C |
| InChI | InChI=1S/C11H24N2OS/c1-9(2)5-7-13(3)11(14)10(12)6-8-15-4/h9-10H,5-8,12H2,1-4H3/t10-/m0/s1 |
| InChIKey | SOPPQEGGHXBOLP-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |