C12H22N2O5S — CID 175113876
2-[(2-amino-4-methylsulfanylbutanoyl)-(3-hydroxybutanoyl)amino]propanoic acid (PubChem CID 175113876) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-[(2-amino-4-methylsulfanylbutanoyl)-(3-hydroxybutanoyl)amino]propanoic acid.
| Compound Name | 2-[(2-amino-4-methylsulfanylbutanoyl)-(3-hydroxybutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 175113876 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(2-amino-4-methylsulfanylbutanoyl)-(3-hydroxybutanoyl)amino]propanoic acid |
| SMILES | CSCCC(N)C(=O)N(C(=O)CC(C)O)C(C)C(=O)O |
| InChI | InChI=1S/C12H22N2O5S/c1-7(15)6-10(16)14(8(2)12(18)19)11(17)9(13)4-5-20-3/h7-9,15H,4-6,13H2,1-3H3,(H,18,19) |
| InChIKey | QCLIATCODMLCIY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |