C14H30N2O4 — CID 169005613
2-amino-N-(2,2-diethoxyethyl)-3-hydroxy-N-(2-methylbutyl)propanamide (PubChem CID 169005613) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-amino-N-(2,2-diethoxyethyl)-3-hydroxy-N-(2-methylbutyl)propanamide.
| Compound Name | 2-amino-N-(2,2-diethoxyethyl)-3-hydroxy-N-(2-methylbutyl)propanamide |
|---|---|
| PubChem CID | 169005613 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-amino-N-(2,2-diethoxyethyl)-3-hydroxy-N-(2-methylbutyl)propanamide |
| SMILES | CCOC(CN(CC(C)CC)C(=O)C(N)CO)OCC |
| InChI | InChI=1S/C14H30N2O4/c1-5-11(4)8-16(14(18)12(15)10-17)9-13(19-6-2)20-7-3/h11-13,17H,5-10,15H2,1-4H3 |
| InChIKey | SENRIHWHYZGOSI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|