C23H45N3O6 — CID 175985142
ethyl N-[3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl]carbamate (PubChem CID 175985142) has the molecular formula C23H45N3O6 and a molecular weight of 459.63 g/mol. Its IUPAC name is ethyl N-[3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl]carbamate.
| Compound Name | ethyl N-[3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 175985142 |
| Molecular Formula | C23H45N3O6 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | ethyl N-[3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl]carbamate |
| SMILES | CCOC(=O)NCCC(=O)NC(CC(C)C)C(=O)N(CC(C)CC)CC(OCC)OCC |
| InChI | InChI=1S/C23H45N3O6/c1-8-18(7)15-26(16-21(30-9-2)31-10-3)22(28)19(14-17(5)6)25-20(27)12-13-24-23(29)32-11-4/h17-19,21H,8-16H2,1-7H3,(H,24,29)(H,25,27) |
| InChIKey | MAUBDZWLURTRRG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|