C21H41N3O6 — CID 175449259
[3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl] carbamate (PubChem CID 175449259) has the molecular formula C21H41N3O6 and a molecular weight of 431.57 g/mol. Its IUPAC name is [3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl] carbamate.
| Compound Name | [3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl] carbamate |
|---|---|
| PubChem CID | 175449259 |
| Molecular Formula | C21H41N3O6 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | [3-[[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-oxopropyl] carbamate |
| SMILES | CCOC(CN(CC(C)CC)C(=O)C(CC(C)C)NC(=O)CCOC(N)=O)OCC |
| InChI | InChI=1S/C21H41N3O6/c1-7-16(6)13-24(14-19(28-8-2)29-9-3)20(26)17(12-15(4)5)23-18(25)10-11-30-21(22)27/h15-17,19H,7-14H2,1-6H3,(H2,22,27)(H,23,25) |
| InChIKey | ZSDUCOSZWONYHB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|