C16H32N2O6 — CID 175713309
methyl N-[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 175713309) has the molecular formula C16H32N2O6 and a molecular weight of 348.44 g/mol. Its IUPAC name is methyl N-[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175713309 |
| Molecular Formula | C16H32N2O6 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl N-[1-[2,2-diethoxyethyl(2-methylbutyl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CCOC(CN(CC(C)CC)C(=O)C(CO)NC(=O)OC)OCC |
| InChI | InChI=1S/C16H32N2O6/c1-6-12(4)9-18(10-14(23-7-2)24-8-3)15(20)13(11-19)17-16(21)22-5/h12-14,19H,6-11H2,1-5H3,(H,17,21) |
| InChIKey | KLVNVDSPZMINCR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|