C13H25FmN2O4- — CID 163281667
(2S)-N-(2,2-dimethoxyethyl)-N-(2-methylbutyl)-2-(oxomethylamino)propanamide;fermium (PubChem CID 163281667) has the molecular formula C13H25FmN2O4- and a molecular weight of 530.35 g/mol. Its IUPAC name is (2S)-N-(2,2-dimethoxyethyl)-N-(2-methylbutyl)-2-(oxomethylamino)propanamide;fermium.
| Compound Name | (2S)-N-(2,2-dimethoxyethyl)-N-(2-methylbutyl)-2-(oxomethylamino)propanamide;fermium |
|---|---|
| PubChem CID | 163281667 |
| Molecular Formula | C13H25FmN2O4- |
| Molecular Weight | 530.35 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | (2S)-N-(2,2-dimethoxyethyl)-N-(2-methylbutyl)-2-(oxomethylamino)propanamide;fermium |
| SMILES | CCC(C)CN(CC(OC)OC)C(=O)[C@H](C)N[C-]=O.[Fm] |
| InChI | InChI=1S/C13H25N2O4.Fm/c1-6-10(2)7-15(8-12(18-4)19-5)13(17)11(3)14-9-16;/h10-12H,6-8H2,1-5H3,(H,14,16);/q-1;/t10?,11-;/m0./s1 |
| InChIKey | ZMKSVJLPJOLSLE-GQNCZFCYSA-N |
| XLogP | 0.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|