C27H40N2O3 — CID 4687222
1-(2,2-diethoxyethyl)-3-[2,6-di(propan-2-yl)phenyl]-1-(2-phenylethyl)urea (PubChem CID 4687222) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-[2,6-di(propan-2-yl)phenyl]-1-(2-phenylethyl)urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-[2,6-di(propan-2-yl)phenyl]-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 4687222 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-[2,6-di(propan-2-yl)phenyl]-1-(2-phenylethyl)urea |
| SMILES | CCOC(CN(CCc1ccccc1)C(=O)Nc1c(C(C)C)cccc1C(C)C)OCC |
| InChI | InChI=1S/C27H40N2O3/c1-7-31-25(32-8-2)19-29(18-17-22-13-10-9-11-14-22)27(30)28-26-23(20(3)4)15-12-16-24(26)21(5)6/h9-16,20-21,25H,7-8,17-19H2,1-6H3,(H,28,30) |
| InChIKey | WUIMXXFYIVRREH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|