C25H32N2O7 — CID 3379705
dimethyl 5-[[2,2-diethoxyethyl(2-phenylethyl)carbamoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3379705) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is dimethyl 5-[[2,2-diethoxyethyl(2-phenylethyl)carbamoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2,2-diethoxyethyl(2-phenylethyl)carbamoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3379705 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | dimethyl 5-[[2,2-diethoxyethyl(2-phenylethyl)carbamoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(CN(CCc1ccccc1)C(=O)Nc1cc(C(=O)OC)cc(C(=O)OC)c1)OCC |
| InChI | InChI=1S/C25H32N2O7/c1-5-33-22(34-6-2)17-27(13-12-18-10-8-7-9-11-18)25(30)26-21-15-19(23(28)31-3)14-20(16-21)24(29)32-4/h7-11,14-16,22H,5-6,12-13,17H2,1-4H3,(H,26,30) |
| InChIKey | WBXYANUNBSTCTF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|