C21H27IN2O3 — CID 3779879
1-(2,2-diethoxyethyl)-3-(4-iodophenyl)-1-(2-phenylethyl)urea (PubChem CID 3779879) has the molecular formula C21H27IN2O3 and a molecular weight of 482.36 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-(4-iodophenyl)-1-(2-phenylethyl)urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-(4-iodophenyl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 3779879 |
| Molecular Formula | C21H27IN2O3 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-(4-iodophenyl)-1-(2-phenylethyl)urea |
| SMILES | CCOC(CN(CCc1ccccc1)C(=O)Nc1ccc(I)cc1)OCC |
| InChI | InChI=1S/C21H27IN2O3/c1-3-26-20(27-4-2)16-24(15-14-17-8-6-5-7-9-17)21(25)23-19-12-10-18(22)11-13-19/h5-13,20H,3-4,14-16H2,1-2H3,(H,23,25) |
| InChIKey | YXNCLWJGRDKZSR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|