C22H29ClN2O2S — CID 3765092
3-(2-chloro-4-methylphenyl)-1-(2,2-diethoxyethyl)-1-(2-phenylethyl)thiourea (PubChem CID 3765092) has the molecular formula C22H29ClN2O2S and a molecular weight of 421.01 g/mol. Its IUPAC name is 3-(2-chloro-4-methylphenyl)-1-(2,2-diethoxyethyl)-1-(2-phenylethyl)thiourea.
| Compound Name | 3-(2-chloro-4-methylphenyl)-1-(2,2-diethoxyethyl)-1-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3765092 |
| Molecular Formula | C22H29ClN2O2S |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-(2-chloro-4-methylphenyl)-1-(2,2-diethoxyethyl)-1-(2-phenylethyl)thiourea |
| SMILES | CCOC(CN(CCc1ccccc1)C(=S)Nc1ccc(C)cc1Cl)OCC |
| InChI | InChI=1S/C22H29ClN2O2S/c1-4-26-21(27-5-2)16-25(14-13-18-9-7-6-8-10-18)22(28)24-20-12-11-17(3)15-19(20)23/h6-12,15,21H,4-5,13-14,16H2,1-3H3,(H,24,28) |
| InChIKey | CCFONLPWLZNJSD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|