C23H32N2O2S — CID 3780789
1-(2,2-diethoxyethyl)-1,3-bis(2-phenylethyl)thiourea (PubChem CID 3780789) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-1,3-bis(2-phenylethyl)thiourea.
| Compound Name | 1-(2,2-diethoxyethyl)-1,3-bis(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3780789 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-1,3-bis(2-phenylethyl)thiourea |
| SMILES | CCOC(CN(CCc1ccccc1)C(=S)NCCc1ccccc1)OCC |
| InChI | InChI=1S/C23H32N2O2S/c1-3-26-22(27-4-2)19-25(18-16-21-13-9-6-10-14-21)23(28)24-17-15-20-11-7-5-8-12-20/h5-14,22H,3-4,15-19H2,1-2H3,(H,24,28) |
| InChIKey | BWQILJOFJADMPS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|