C15H23N3OS — CID 9213557
N-ethyl-2-[ethyl(2-phenylethylcarbamothioyl)amino]acetamide (PubChem CID 9213557) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-ethyl-2-[ethyl(2-phenylethylcarbamothioyl)amino]acetamide.
| Compound Name | N-ethyl-2-[ethyl(2-phenylethylcarbamothioyl)amino]acetamide |
|---|---|
| PubChem CID | 9213557 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-ethyl-2-[ethyl(2-phenylethylcarbamothioyl)amino]acetamide |
| SMILES | CCNC(=O)CN(CC)C(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C15H23N3OS/c1-3-16-14(19)12-18(4-2)15(20)17-11-10-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | CEWGIUHUURJOLY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|