C28H26Cl2FN3S — CID 5210147
1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-chloro-4-methylphenyl)-1-(2-phenylethyl)thiourea (PubChem CID 5210147) has the molecular formula C28H26Cl2FN3S and a molecular weight of 526.51 g/mol. Its IUPAC name is 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-chloro-4-methylphenyl)-1-(2-phenylethyl)thiourea.
| Compound Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-chloro-4-methylphenyl)-1-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 5210147 |
| Molecular Formula | C28H26Cl2FN3S |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-chloro-4-methylphenyl)-1-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCc2ccccc2)Cc2cccn2Cc2ccc(F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H26Cl2FN3S/c1-20-9-12-27(26(30)16-20)32-28(35)34(15-13-21-6-3-2-4-7-21)19-24-8-5-14-33(24)18-22-10-11-23(31)17-25(22)29/h2-12,14,16-17H,13,15,18-19H2,1H3,(H,32,35) |
| InChIKey | IRCGRPRQTGEICZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|