C21H20ClFN4S — CID 4073720
1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 4073720) has the molecular formula C21H20ClFN4S and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4073720 |
| Molecular Formula | C21H20ClFN4S |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NN=Cc2cccn2Cc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C21H20ClFN4S/c1-14-5-6-15(2)20(10-14)25-21(28)26-24-12-18-4-3-9-27(18)13-16-7-8-17(23)11-19(16)22/h3-12H,13H2,1-2H3,(H2,25,26,28) |
| InChIKey | RDEINBFGRRHDHY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|