C20H19ClN4S — CID 46372066
1-[(E)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2-methylphenyl)thiourea (PubChem CID 46372066) has the molecular formula C20H19ClN4S and a molecular weight of 382.92 g/mol. Its IUPAC name is 1-[(E)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(E)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 46372066 |
| Molecular Formula | C20H19ClN4S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[(E)-[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N/N=C/c1cccn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN4S/c1-15-5-2-3-7-19(15)23-20(26)24-22-13-18-6-4-12-25(18)14-16-8-10-17(21)11-9-16/h2-13H,14H2,1H3,(H2,23,24,26)/b22-13+ |
| InChIKey | UPVFCARXSIXCOJ-LPYMAVHISA-N |
| XLogP | 4.82 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|