C21H21ClN4S — CID 46372139
1-[(E)-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 46372139) has the molecular formula C21H21ClN4S and a molecular weight of 396.95 g/mol. Its IUPAC name is 1-[(E)-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[(E)-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 46372139 |
| Molecular Formula | C21H21ClN4S |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-[(E)-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N/N=C/c2cccn2Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H21ClN4S/c1-15-9-10-16(2)20(12-15)24-21(27)25-23-13-18-7-5-11-26(18)14-17-6-3-4-8-19(17)22/h3-13H,14H2,1-2H3,(H2,24,25,27)/b23-13+ |
| InChIKey | MWLDURPPZJYYFM-YDZHTSKRSA-N |
| XLogP | 5.13 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|