C23H24ClFN4S — CID 4073721
1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,6-diethylphenyl)thiourea (PubChem CID 4073721) has the molecular formula C23H24ClFN4S and a molecular weight of 442.99 g/mol. Its IUPAC name is 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,6-diethylphenyl)thiourea.
| Compound Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,6-diethylphenyl)thiourea |
|---|---|
| PubChem CID | 4073721 |
| Molecular Formula | C23H24ClFN4S |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(2,6-diethylphenyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NN=Cc1cccn1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H24ClFN4S/c1-3-16-7-5-8-17(4-2)22(16)27-23(30)28-26-14-20-9-6-12-29(20)15-18-10-11-19(25)13-21(18)24/h5-14H,3-4,15H2,1-2H3,(H2,27,28,30) |
| InChIKey | XTKFNARCIPOJRZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|