C22H22ClFN4S — CID 4073718
1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 4073718) has the molecular formula C22H22ClFN4S and a molecular weight of 428.96 g/mol. Its IUPAC name is 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 4073718 |
| Molecular Formula | C22H22ClFN4S |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methylideneamino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccc(NC(=S)NN=Cc2cccn2Cc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C22H22ClFN4S/c1-15(2)16-6-9-19(10-7-16)26-22(29)27-25-13-20-4-3-11-28(20)14-17-5-8-18(24)12-21(17)23/h3-13,15H,14H2,1-2H3,(H2,26,27,29) |
| InChIKey | JFBIQEXPISDTPS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|