C22H24N4S — CID 5204557
1-(3-ethylphenyl)-3-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea (PubChem CID 5204557) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-3-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea.
| Compound Name | 1-(3-ethylphenyl)-3-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 5204557 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-(3-ethylphenyl)-3-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methylideneamino]thiourea |
| SMILES | CCc1cccc(NC(=S)NN=Cc2cccn2Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H24N4S/c1-3-18-6-4-7-20(14-18)24-22(27)25-23-15-21-8-5-13-26(21)16-19-11-9-17(2)10-12-19/h4-15H,3,16H2,1-2H3,(H2,24,25,27) |
| InChIKey | HXYOYDCOTYRCTQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|