C28H27ClFN3OS — CID 3276953
1-benzyl-1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-ethoxyphenyl)thiourea (PubChem CID 3276953) has the molecular formula C28H27ClFN3OS and a molecular weight of 508.06 g/mol. Its IUPAC name is 1-benzyl-1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-benzyl-1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3276953 |
| Molecular Formula | C28H27ClFN3OS |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-benzyl-1-[[1-[(2-chloro-4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)N(Cc1ccccc1)Cc1cccn1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C28H27ClFN3OS/c1-2-34-27-13-7-6-12-26(27)31-28(35)33(18-21-9-4-3-5-10-21)20-24-11-8-16-32(24)19-22-14-15-23(30)17-25(22)29/h3-17H,2,18-20H2,1H3,(H,31,35) |
| InChIKey | VRFGGIMFUISTQX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|