C27H26ClN3S2 — CID 5085578
1-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-methylsulfanylphenyl)thiourea (PubChem CID 5085578) has the molecular formula C27H26ClN3S2 and a molecular weight of 492.11 g/mol. Its IUPAC name is 1-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-methylsulfanylphenyl)thiourea.
| Compound Name | 1-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 5085578 |
| Molecular Formula | C27H26ClN3S2 |
| Molecular Weight | 492.11 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 1-benzyl-1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3-methylsulfanylphenyl)thiourea |
| SMILES | CSc1cccc(NC(=S)N(Cc2ccccc2)Cc2cccn2Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C27H26ClN3S2/c1-33-26-14-6-12-24(17-26)29-27(32)31(18-21-8-3-2-4-9-21)20-25-13-7-15-30(25)19-22-10-5-11-23(28)16-22/h2-17H,18-20H2,1H3,(H,29,32) |
| InChIKey | SLUBWQJEGFWNHG-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.11 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|