C23H26ClN3OS — CID 3458345
1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(4-methylsulfanylphenyl)-1-propylurea (PubChem CID 3458345) has the molecular formula C23H26ClN3OS and a molecular weight of 428.00 g/mol. Its IUPAC name is 1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(4-methylsulfanylphenyl)-1-propylurea.
| Compound Name | 1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(4-methylsulfanylphenyl)-1-propylurea |
|---|---|
| PubChem CID | 3458345 |
| Molecular Formula | C23H26ClN3OS |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[[1-[(3-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(4-methylsulfanylphenyl)-1-propylurea |
| SMILES | CCCN(Cc1cccn1Cc1cccc(Cl)c1)C(=O)Nc1ccc(SC)cc1 |
| InChI | InChI=1S/C23H26ClN3OS/c1-3-13-27(23(28)25-20-9-11-22(29-2)12-10-20)17-21-8-5-14-26(21)16-18-6-4-7-19(24)15-18/h4-12,14-15H,3,13,16-17H2,1-2H3,(H,25,28) |
| InChIKey | XWZVXTGQWQXWQI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |