C27H23Cl4N3S — CID 3628563
1-[2-(4-chlorophenyl)ethyl]-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3,5-dichlorophenyl)thiourea (PubChem CID 3628563) has the molecular formula C27H23Cl4N3S and a molecular weight of 563.38 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 3628563 |
| Molecular Formula | C27H23Cl4N3S |
| Molecular Weight | 563.38 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-1-[[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]methyl]-3-(3,5-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1cc(Cl)cc(Cl)c1)N(CCc1ccc(Cl)cc1)Cc1cccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H23Cl4N3S/c28-21-9-7-19(8-10-21)11-13-34(27(35)32-24-15-22(29)14-23(30)16-24)18-25-5-3-12-33(25)17-20-4-1-2-6-26(20)31/h1-10,12,14-16H,11,13,17-18H2,(H,32,35) |
| InChIKey | KLUZJUIZDHPBEF-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.38 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|