C20H34N2O3 — CID 169240585
(2R)-2-(aminomethyl)-N-butyl-N-(2,2-diethoxyethyl)-3-phenylpropanamide (PubChem CID 169240585) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)-N-butyl-N-(2,2-diethoxyethyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-(aminomethyl)-N-butyl-N-(2,2-diethoxyethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 169240585 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (2R)-2-(aminomethyl)-N-butyl-N-(2,2-diethoxyethyl)-3-phenylpropanamide |
| SMILES | CCCCN(CC(OCC)OCC)C(=O)[C@@H](CN)Cc1ccccc1 |
| InChI | InChI=1S/C20H34N2O3/c1-4-7-13-22(16-19(24-5-2)25-6-3)20(23)18(15-21)14-17-11-9-8-10-12-17/h8-12,18-19H,4-7,13-16,21H2,1-3H3/t18-/m1/s1 |
| InChIKey | HSCADVLCDWHZJM-GOSISDBHSA-N |
| XLogP | 2.83 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|