C26H34N3O7+ — CID 123970093
2-[[2-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-2-oxoethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylazanium (PubChem CID 123970093) has the molecular formula C26H34N3O7+ and a molecular weight of 500.57 g/mol. Its IUPAC name is 2-[[2-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-2-oxoethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylazanium.
| Compound Name | 2-[[2-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-2-oxoethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylazanium |
|---|---|
| PubChem CID | 123970093 |
| Molecular Formula | C26H34N3O7+ |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-[[2-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-2-oxoethyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]ethylazanium |
| SMILES | [NH3+]CCN(CC(=O)NCCOCCOCCC(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H33N3O7/c27-10-12-29(17-24(30)28-11-14-35-16-15-34-13-9-25(31)32)26(33)36-18-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-8,23H,9-18,27H2,(H,28,30)(H,31,32)/p+1 |
| InChIKey | WLJZJDKJDCKEDO-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|