C26H32N2O6 — CID 126673423
(2R)-6-[9H-fluoren-9-yl(methoxycarbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 126673423) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2R)-6-[9H-fluoren-9-yl(methoxycarbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2R)-6-[9H-fluoren-9-yl(methoxycarbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 126673423 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2R)-6-[9H-fluoren-9-yl(methoxycarbonyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | COC(=O)N(CCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H32N2O6/c1-26(2,3)34-24(31)27-21(23(29)30)15-9-10-16-28(25(32)33-4)22-19-13-7-5-11-17(19)18-12-6-8-14-20(18)22/h5-8,11-14,21-22H,9-10,15-16H2,1-4H3,(H,27,31)(H,29,30)/t21-/m1/s1 |
| InChIKey | LDZGHGCQQXDIIT-OAQYLSRUSA-N |
| XLogP | 4.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|