C53H62N2O10 — CID 70041676
prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 70041676) has the molecular formula C53H62N2O10 and a molecular weight of 887.08 g/mol. Its IUPAC name is prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 70041676 |
| Molecular Formula | C53H62N2O10 |
| Molecular Weight | 887.08 g/mol |
| Exact Mass | 886.44 |
| IUPAC Name | prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | C=CCOC(=O)COCCOCCOCCN(CCOCCOCCOCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C53H62N2O10/c1-2-29-64-51(56)42-63-40-39-62-38-35-60-32-28-55(52(57)65-41-50-48-24-14-12-22-46(48)47-23-13-15-25-49(47)50)27-31-59-34-37-61-36-33-58-30-26-54-53(43-16-6-3-7-17-43,44-18-8-4-9-19-44)45-20-10-5-11-21-45/h2-25,50,54H,1,26-42H2 |
| InChIKey | QHRUAUJMTAATIX-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.08 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|