C19H19NO3 — CID 57151927
9H-fluoren-9-ylmethyl N-(hydroxymethyl)-N-prop-2-enylcarbamate (PubChem CID 57151927) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(hydroxymethyl)-N-prop-2-enylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(hydroxymethyl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 57151927 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(hydroxymethyl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CO)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H19NO3/c1-2-11-20(13-21)19(22)23-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18,21H,1,11-13H2 |
| InChIKey | UXCAUNTWUFACLF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|