C29H31NO4 — CID 165479101
3-[(4-tert-butylphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (PubChem CID 165479101) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid.
| Compound Name | 3-[(4-tert-butylphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 165479101 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| SMILES | CC(C)(C)c1ccc(CN(CCC(=O)O)C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C29H31NO4/c1-29(2,3)21-14-12-20(13-15-21)18-30(17-16-27(31)32)28(33)34-19-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h4-15,26H,16-19H2,1-3H3,(H,31,32) |
| InChIKey | VUEFJBGZFJVXDF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |