C25H22FNO4 — CID 165469984
3-[9H-fluoren-9-ylmethoxycarbonyl-[(3-fluorophenyl)methyl]amino]propanoic acid (PubChem CID 165469984) has the molecular formula C25H22FNO4 and a molecular weight of 419.45 g/mol. Its IUPAC name is 3-[9H-fluoren-9-ylmethoxycarbonyl-[(3-fluorophenyl)methyl]amino]propanoic acid.
| Compound Name | 3-[9H-fluoren-9-ylmethoxycarbonyl-[(3-fluorophenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165469984 |
| Molecular Formula | C25H22FNO4 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-[9H-fluoren-9-ylmethoxycarbonyl-[(3-fluorophenyl)methyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1cccc(F)c1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22FNO4/c26-18-7-5-6-17(14-18)15-27(13-12-24(28)29)25(30)31-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-11,14,23H,12-13,15-16H2,(H,28,29) |
| InChIKey | KMYXMBRLAWVMQF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |