C47H50N6O3 — CID 162190536
N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]acetamide;9H-fluoren-9-ylmethyl N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]carbamate (PubChem CID 162190536) has the molecular formula C47H50N6O3 and a molecular weight of 746.96 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]acetamide;9H-fluoren-9-ylmethyl N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]carbamate.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]acetamide;9H-fluoren-9-ylmethyl N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 162190536 |
| Molecular Formula | C47H50N6O3 |
| Molecular Weight | 746.96 g/mol |
| Exact Mass | 746.39 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]acetamide;9H-fluoren-9-ylmethyl N-[2-(4-aminophenyl)ethyl]-N-[(4-aminophenyl)methyl]carbamate |
| SMILES | CC(=O)N(CCc1ccc(N)cc1)Cc1ccc(N)cc1.Nc1ccc(CCN(Cc2ccc(N)cc2)C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H29N3O2.C17H21N3O/c31-23-13-9-21(10-14-23)17-18-33(19-22-11-15-24(32)16-12-22)30(34)35-20-29-27-7-3-1-5-25(27)26-6-2-4-8-28(26)29;1-13(21)20(12-15-4-8-17(19)9-5-15)11-10-14-2-6-16(18)7-3-14/h1-16,29H,17-20,31-32H2;2-9H,10-12,18-19H2,1H3 |
| InChIKey | ZQFXEQSOBWUDKH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 153.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.96 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|