C33H31N3O4 — CID 175908789
3-[2-[(4-aminophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]phenyl]pyrrolidine-1-carboxylic acid (PubChem CID 175908789) has the molecular formula C33H31N3O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[2-[(4-aminophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]phenyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[2-[(4-aminophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]phenyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175908789 |
| Molecular Formula | C33H31N3O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 3-[2-[(4-aminophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]phenyl]pyrrolidine-1-carboxylic acid |
| SMILES | Nc1ccc(CN(C(=O)OCC2c3ccccc3-c3ccccc32)c2ccccc2C2CCN(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C33H31N3O4/c34-24-15-13-22(14-16-24)19-36(31-12-6-5-7-25(31)23-17-18-35(20-23)32(37)38)33(39)40-21-30-28-10-3-1-8-26(28)27-9-2-4-11-29(27)30/h1-16,23,30H,17-21,34H2,(H,37,38) |
| InChIKey | SWLPVNUDIOSRFV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|