C26H25IN2O3 — CID 90221747
[2-[[acetyl(methyl)amino]methyl]-9H-fluoren-9-yl]methyl N-(iodomethyl)-N-phenylcarbamate (PubChem CID 90221747) has the molecular formula C26H25IN2O3 and a molecular weight of 540.40 g/mol. Its IUPAC name is [2-[[acetyl(methyl)amino]methyl]-9H-fluoren-9-yl]methyl N-(iodomethyl)-N-phenylcarbamate.
| Compound Name | [2-[[acetyl(methyl)amino]methyl]-9H-fluoren-9-yl]methyl N-(iodomethyl)-N-phenylcarbamate |
|---|---|
| PubChem CID | 90221747 |
| Molecular Formula | C26H25IN2O3 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | [2-[[acetyl(methyl)amino]methyl]-9H-fluoren-9-yl]methyl N-(iodomethyl)-N-phenylcarbamate |
| SMILES | CC(=O)N(C)Cc1ccc2c(c1)C(COC(=O)N(CI)c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C26H25IN2O3/c1-18(30)28(2)15-19-12-13-23-21-10-6-7-11-22(21)25(24(23)14-19)16-32-26(31)29(17-27)20-8-4-3-5-9-20/h3-14,25H,15-17H2,1-2H3 |
| InChIKey | NOUKLKTWLOMSQZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|