C29H22ClNO3 — CID 139466247
9H-fluoren-9-ylmethyl N-[(4-chlorophenyl)methyl]-N-(4-formylphenyl)carbamate (PubChem CID 139466247) has the molecular formula C29H22ClNO3 and a molecular weight of 467.95 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(4-chlorophenyl)methyl]-N-(4-formylphenyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(4-chlorophenyl)methyl]-N-(4-formylphenyl)carbamate |
|---|---|
| PubChem CID | 139466247 |
| Molecular Formula | C29H22ClNO3 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(4-chlorophenyl)methyl]-N-(4-formylphenyl)carbamate |
| SMILES | O=Cc1ccc(N(Cc2ccc(Cl)cc2)C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C29H22ClNO3/c30-22-13-9-20(10-14-22)17-31(23-15-11-21(18-32)12-16-23)29(33)34-19-28-26-7-3-1-5-24(26)25-6-2-4-8-27(25)28/h1-16,18,28H,17,19H2 |
| InChIKey | MRSVODWJJPXUDV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|