C35H39F6N3O7 — CID 175290722
benzyl-[6-[bis[[4-(trifluoromethoxy)phenyl]methyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid (PubChem CID 175290722) has the molecular formula C35H39F6N3O7 and a molecular weight of 727.70 g/mol. Its IUPAC name is benzyl-[6-[bis[[4-(trifluoromethoxy)phenyl]methyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid.
| Compound Name | benzyl-[6-[bis[[4-(trifluoromethoxy)phenyl]methyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 175290722 |
| Molecular Formula | C35H39F6N3O7 |
| Molecular Weight | 727.70 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | benzyl-[6-[bis[[4-(trifluoromethoxy)phenyl]methyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCN(Cc1ccccc1)C(=O)O)C(=O)N(Cc1ccc(OC(F)(F)F)cc1)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C35H39F6N3O7/c1-33(2,3)51-31(46)42-29(11-7-8-20-43(32(47)48)21-24-9-5-4-6-10-24)30(45)44(22-25-12-16-27(17-13-25)49-34(36,37)38)23-26-14-18-28(19-15-26)50-35(39,40)41/h4-6,9-10,12-19,29H,7-8,11,20-23H2,1-3H3,(H,42,46)(H,47,48) |
| InChIKey | WXNFGCLDIVUNLL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.70 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|